C14H17F2NO2 — CID 90236272
[(1S,2R)-2-(benzylamino)-3,3-difluorocyclopentyl] acetate (PubChem CID 90236272) has the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. Its IUPAC name is [(1S,2R)-2-(benzylamino)-3,3-difluorocyclopentyl] acetate.
| Compound Name | [(1S,2R)-2-(benzylamino)-3,3-difluorocyclopentyl] acetate |
|---|---|
| PubChem CID | 90236272 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | [(1S,2R)-2-(benzylamino)-3,3-difluorocyclopentyl] acetate |
| SMILES | CC(=O)O[C@H]1CCC(F)(F)[C@@H]1NCc1ccccc1 |
| InChI | InChI=1S/C14H17F2NO2/c1-10(18)19-12-7-8-14(15,16)13(12)17-9-11-5-3-2-4-6-11/h2-6,12-13,17H,7-9H2,1H3/t12-,13+/m0/s1 |
| InChIKey | JQQHVUPXBAOLHS-QWHCGFSZSA-N |
| XLogP | 2.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |