About [2-(benzylamino)-3,3-difluorocyclopentyl] acetate
[2-(benzylamino)-3,3-difluorocyclopentyl] acetate (PubChem CID 90236273) has the molecular formula C14H17F2NO2
and a molecular weight of 269.29 g/mol. Its IUPAC name is [2-(benzylamino)-3,3-difluorocyclopentyl] acetate.
Molecular Properties
| Compound Name | [2-(benzylamino)-3,3-difluorocyclopentyl] acetate |
| PubChem CID | 90236273 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | [2-(benzylamino)-3,3-difluorocyclopentyl] acetate |
| SMILES | CC(=O)OC1CCC(F)(F)C1NCc1ccccc1 |
| InChI | InChI=1S/C14H17F2NO2/c1-10(18)19-12-7-8-14(15,16)13(12)17-9-11-5-3-2-4-6-11/h2-6,12-13,17H,7-9H2,1H3 |
| InChIKey | JQQHVUPXBAOLHS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(benzylamino)-3,3-difluorocyclopentyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(benzylamino)-3,3-difluorocyclopentyl] acetate?
The IUPAC name of [2-(benzylamino)-3,3-difluorocyclopentyl] acetate (CID 90236273) is [2-(benzylamino)-3,3-difluorocyclopentyl] acetate.
What is the SMILES notation for [2-(benzylamino)-3,3-difluorocyclopentyl] acetate?
The canonical SMILES for [2-(benzylamino)-3,3-difluorocyclopentyl] acetate is CC(=O)OC1CCC(F)(F)C1NCc1ccccc1.
What is the InChIKey of [2-(benzylamino)-3,3-difluorocyclopentyl] acetate?
The InChIKey is JQQHVUPXBAOLHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2NO2/c1-10(18)19-12-7-8-14(15,16)13(12)17-9-11-5-3-2-4-6-11/h2-6,12-13,17H,7-9H2,1H3.
What are the key properties of [2-(benzylamino)-3,3-difluorocyclopentyl] acetate?
[2-(benzylamino)-3,3-difluorocyclopentyl] acetate has a molecular weight of 269.29 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(benzylamino)-3,3-difluorocyclopentyl] acetate is sourced from PubChem (CID 90236273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).