About 4-chloro-2-(2-chloroethyl)-6,7-dimethoxyquinazoline
4-chloro-2-(2-chloroethyl)-6,7-dimethoxyquinazoline (PubChem CID 90236933) has the molecular formula C12H12Cl2N2O2
and a molecular weight of 287.15 g/mol. Its IUPAC name is 4-chloro-2-(2-chloroethyl)-6,7-dimethoxyquinazoline.
Molecular Properties
| Compound Name | 4-chloro-2-(2-chloroethyl)-6,7-dimethoxyquinazoline |
| PubChem CID | 90236933 |
| Molecular Formula | C12H12Cl2N2O2 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 4-chloro-2-(2-chloroethyl)-6,7-dimethoxyquinazoline |
| SMILES | COc1cc2nc(CCCl)nc(Cl)c2cc1OC |
| InChI | InChI=1S/C12H12Cl2N2O2/c1-17-9-5-7-8(6-10(9)18-2)15-11(3-4-13)16-12(7)14/h5-6H,3-4H2,1-2H3 |
| InChIKey | VTQHVQIGFZBZFE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-(2-chloroethyl)-6,7-dimethoxyquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2-chloroethyl)-6,7-dimethoxyquinazoline?
The IUPAC name of 4-chloro-2-(2-chloroethyl)-6,7-dimethoxyquinazoline (CID 90236933) is 4-chloro-2-(2-chloroethyl)-6,7-dimethoxyquinazoline.
What is the SMILES notation for 4-chloro-2-(2-chloroethyl)-6,7-dimethoxyquinazoline?
The canonical SMILES for 4-chloro-2-(2-chloroethyl)-6,7-dimethoxyquinazoline is COc1cc2nc(CCCl)nc(Cl)c2cc1OC.
What is the InChIKey of 4-chloro-2-(2-chloroethyl)-6,7-dimethoxyquinazoline?
The InChIKey is VTQHVQIGFZBZFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2N2O2/c1-17-9-5-7-8(6-10(9)18-2)15-11(3-4-13)16-12(7)14/h5-6H,3-4H2,1-2H3.
What are the key properties of 4-chloro-2-(2-chloroethyl)-6,7-dimethoxyquinazoline?
4-chloro-2-(2-chloroethyl)-6,7-dimethoxyquinazoline has a molecular weight of 287.15 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2-chloroethyl)-6,7-dimethoxyquinazoline is sourced from PubChem (CID 90236933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).