About 2-(3-aminopropyl)-3-(3,5-difluorophenyl)-5,6-difluoroquinazolin-4-one
2-(3-aminopropyl)-3-(3,5-difluorophenyl)-5,6-difluoroquinazolin-4-one (PubChem CID 90237050) has the molecular formula C17H13F4N3O
and a molecular weight of 351.30 g/mol. Its IUPAC name is 2-(3-aminopropyl)-3-(3,5-difluorophenyl)-5,6-difluoroquinazolin-4-one.
Molecular Properties
| Compound Name | 2-(3-aminopropyl)-3-(3,5-difluorophenyl)-5,6-difluoroquinazolin-4-one |
| PubChem CID | 90237050 |
| Molecular Formula | C17H13F4N3O |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-(3-aminopropyl)-3-(3,5-difluorophenyl)-5,6-difluoroquinazolin-4-one |
| SMILES | NCCCc1nc2ccc(F)c(F)c2c(=O)n1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H13F4N3O/c18-9-6-10(19)8-11(7-9)24-14(2-1-5-22)23-13-4-3-12(20)16(21)15(13)17(24)25/h3-4,6-8H,1-2,5,22H2 |
| InChIKey | FROSTNLSFYKIKT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-aminopropyl)-3-(3,5-difluorophenyl)-5,6-difluoroquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminopropyl)-3-(3,5-difluorophenyl)-5,6-difluoroquinazolin-4-one?
The IUPAC name of 2-(3-aminopropyl)-3-(3,5-difluorophenyl)-5,6-difluoroquinazolin-4-one (CID 90237050) is 2-(3-aminopropyl)-3-(3,5-difluorophenyl)-5,6-difluoroquinazolin-4-one.
What is the SMILES notation for 2-(3-aminopropyl)-3-(3,5-difluorophenyl)-5,6-difluoroquinazolin-4-one?
The canonical SMILES for 2-(3-aminopropyl)-3-(3,5-difluorophenyl)-5,6-difluoroquinazolin-4-one is NCCCc1nc2ccc(F)c(F)c2c(=O)n1-c1cc(F)cc(F)c1.
What is the InChIKey of 2-(3-aminopropyl)-3-(3,5-difluorophenyl)-5,6-difluoroquinazolin-4-one?
The InChIKey is FROSTNLSFYKIKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F4N3O/c18-9-6-10(19)8-11(7-9)24-14(2-1-5-22)23-13-4-3-12(20)16(21)15(13)17(24)25/h3-4,6-8H,1-2,5,22H2.
What are the key properties of 2-(3-aminopropyl)-3-(3,5-difluorophenyl)-5,6-difluoroquinazolin-4-one?
2-(3-aminopropyl)-3-(3,5-difluorophenyl)-5,6-difluoroquinazolin-4-one has a molecular weight of 351.30 g/mol, XLogP of 2.83, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminopropyl)-3-(3,5-difluorophenyl)-5,6-difluoroquinazolin-4-one is sourced from PubChem (CID 90237050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).