C21H17ClF3N7O — CID 90237391
2-[3-[(2,6-diamino-5-chloropyrimidin-4-yl)amino]propyl]-3-(3,5-difluorophenyl)-5-fluoroquinazolin-4-one (PubChem CID 90237391) has the molecular formula C21H17ClF3N7O and a molecular weight of 475.86 g/mol. Its IUPAC name is 2-[3-[(2,6-diamino-5-chloropyrimidin-4-yl)amino]propyl]-3-(3,5-difluorophenyl)-5-fluoroquinazolin-4-one.
| Compound Name | 2-[3-[(2,6-diamino-5-chloropyrimidin-4-yl)amino]propyl]-3-(3,5-difluorophenyl)-5-fluoroquinazolin-4-one |
|---|---|
| PubChem CID | 90237391 |
| Molecular Formula | C21H17ClF3N7O |
| Molecular Weight | 475.86 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 2-[3-[(2,6-diamino-5-chloropyrimidin-4-yl)amino]propyl]-3-(3,5-difluorophenyl)-5-fluoroquinazolin-4-one |
| SMILES | Nc1nc(N)c(Cl)c(NCCCc2nc3cccc(F)c3c(=O)n2-c2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C21H17ClF3N7O/c22-17-18(26)30-21(27)31-19(17)28-6-2-5-15-29-14-4-1-3-13(25)16(14)20(33)32(15)12-8-10(23)7-11(24)9-12/h1,3-4,7-9H,2,5-6H2,(H5,26,27,28,30,31) |
| InChIKey | YWJQEHIEFGJVTM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.86 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|