About 2-cyclopropyl-6,7-dimethoxy-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazoline
2-cyclopropyl-6,7-dimethoxy-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazoline (PubChem CID 90237596) has the molecular formula C25H29N3O3
and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-cyclopropyl-6,7-dimethoxy-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazoline.
Molecular Properties
| Compound Name | 2-cyclopropyl-6,7-dimethoxy-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazoline |
| PubChem CID | 90237596 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-cyclopropyl-6,7-dimethoxy-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazoline |
| SMILES | COc1cc2nc(C3CC3)nc(N3CCC(c4ccccc4OC)CC3)c2cc1OC |
| InChI | InChI=1S/C25H29N3O3/c1-29-21-7-5-4-6-18(21)16-10-12-28(13-11-16)25-19-14-22(30-2)23(31-3)15-20(19)26-24(27-25)17-8-9-17/h4-7,14-17H,8-13H2,1-3H3 |
| InChIKey | KSEPWCUCBVMLMT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-cyclopropyl-6,7-dimethoxy-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-6,7-dimethoxy-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazoline?
The IUPAC name of 2-cyclopropyl-6,7-dimethoxy-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazoline (CID 90237596) is 2-cyclopropyl-6,7-dimethoxy-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazoline.
What is the SMILES notation for 2-cyclopropyl-6,7-dimethoxy-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazoline?
The canonical SMILES for 2-cyclopropyl-6,7-dimethoxy-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazoline is COc1cc2nc(C3CC3)nc(N3CCC(c4ccccc4OC)CC3)c2cc1OC.
What is the InChIKey of 2-cyclopropyl-6,7-dimethoxy-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazoline?
The InChIKey is KSEPWCUCBVMLMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N3O3/c1-29-21-7-5-4-6-18(21)16-10-12-28(13-11-16)25-19-14-22(30-2)23(31-3)15-20(19)26-24(27-25)17-8-9-17/h4-7,14-17H,8-13H2,1-3H3.
What are the key properties of 2-cyclopropyl-6,7-dimethoxy-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazoline?
2-cyclopropyl-6,7-dimethoxy-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazoline has a molecular weight of 419.53 g/mol, XLogP of 4.92, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-6,7-dimethoxy-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazoline is sourced from PubChem (CID 90237596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).