C35H72O5Si3 — CID 90238092
[(2R,3R,4S,5R,6R)-6-ethynyl-3,4,5-tris[tri(propan-2-yl)silyloxy]oxan-2-yl]methanol (PubChem CID 90238092) has the molecular formula C35H72O5Si3 and a molecular weight of 657.21 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-ethynyl-3,4,5-tris[tri(propan-2-yl)silyloxy]oxan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5R,6R)-6-ethynyl-3,4,5-tris[tri(propan-2-yl)silyloxy]oxan-2-yl]methanol |
|---|---|
| PubChem CID | 90238092 |
| Molecular Formula | C35H72O5Si3 |
| Molecular Weight | 657.21 g/mol |
| Exact Mass | 656.47 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-ethynyl-3,4,5-tris[tri(propan-2-yl)silyloxy]oxan-2-yl]methanol |
| SMILES | C#C[C@H]1O[C@H](CO)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C35H72O5Si3/c1-20-31-33(38-41(22(2)3,23(4)5)24(6)7)35(40-43(28(14)15,29(16)17)30(18)19)34(32(21-36)37-31)39-42(25(8)9,26(10)11)27(12)13/h1,22-36H,21H2,2-19H3/t31-,32-,33-,34-,35+/m1/s1 |
| InChIKey | NCUWQCKUEWEEJB-JSMUHSIHSA-N |
| XLogP | 10.06 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.21 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|