About 1-butyl-2-methylpyrrole;hydrobromide
1-butyl-2-methylpyrrole;hydrobromide (PubChem CID 90238176) has the molecular formula C9H16BrN
and a molecular weight of 218.14 g/mol. Its IUPAC name is 1-butyl-2-methylpyrrole;hydrobromide.
Molecular Properties
| Compound Name | 1-butyl-2-methylpyrrole;hydrobromide |
| PubChem CID | 90238176 |
| Molecular Formula | C9H16BrN |
| Molecular Weight | 218.14 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 1-butyl-2-methylpyrrole;hydrobromide |
| SMILES | Br.CCCCn1cccc1C |
| InChI | InChI=1S/C9H15N.BrH/c1-3-4-7-10-8-5-6-9(10)2;/h5-6,8H,3-4,7H2,1-2H3;1H |
| InChIKey | XEZJQYUYMZTOHX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butyl-2-methylpyrrole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-methylpyrrole;hydrobromide?
The IUPAC name of 1-butyl-2-methylpyrrole;hydrobromide (CID 90238176) is 1-butyl-2-methylpyrrole;hydrobromide.
What is the SMILES notation for 1-butyl-2-methylpyrrole;hydrobromide?
The canonical SMILES for 1-butyl-2-methylpyrrole;hydrobromide is Br.CCCCn1cccc1C.
What is the InChIKey of 1-butyl-2-methylpyrrole;hydrobromide?
The InChIKey is XEZJQYUYMZTOHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N.BrH/c1-3-4-7-10-8-5-6-9(10)2;/h5-6,8H,3-4,7H2,1-2H3;1H.
What are the key properties of 1-butyl-2-methylpyrrole;hydrobromide?
1-butyl-2-methylpyrrole;hydrobromide has a molecular weight of 218.14 g/mol, XLogP of 3.17, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-methylpyrrole;hydrobromide is sourced from PubChem (CID 90238176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).