C34H36O12 — CID 90238295
2,7-bis[2-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,5'-oxepane]-2'-one (PubChem CID 90238295) has the molecular formula C34H36O12 and a molecular weight of 636.65 g/mol. Its IUPAC name is 2,7-bis[2-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,5'-oxepane]-2'-one.
| Compound Name | 2,7-bis[2-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,5'-oxepane]-2'-one |
|---|---|
| PubChem CID | 90238295 |
| Molecular Formula | C34H36O12 |
| Molecular Weight | 636.65 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | 2,7-bis[2-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,5'-oxepane]-2'-one |
| SMILES | O=C1CCC2(CCO1)c1cc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc1-c1ccc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc12 |
| InChI | InChI=1S/C34H36O12/c35-15-25-30(40)32(42)28(38)23(45-25)7-3-17-1-5-19-20-6-2-18(4-8-24-29(39)33(43)31(41)26(16-36)46-24)14-22(20)34(21(19)13-17)10-9-27(37)44-12-11-34/h1-2,5-6,13-14,23-26,28-33,35-36,38-43H,9-12,15-16H2/t23-,24-,25-,26-,28+,29+,30-,31-,32-,33-/m1/s1 |
| InChIKey | CDFHCRKTXNFLLT-YHMDOXNHSA-N |
| XLogP | -1.93 |
| TPSA | 206.60 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.65 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|