About tert-butyl N-[3-(3,5-difluorophenyl)-4-oxo-8-(trifluoromethyl)quinazolin-2-yl]-N-ethylcarbamate
tert-butyl N-[3-(3,5-difluorophenyl)-4-oxo-8-(trifluoromethyl)quinazolin-2-yl]-N-ethylcarbamate (PubChem CID 90238300) has the molecular formula C22H20F5N3O3
and a molecular weight of 469.41 g/mol. Its IUPAC name is tert-butyl N-[3-(3,5-difluorophenyl)-4-oxo-8-(trifluoromethyl)quinazolin-2-yl]-N-ethylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[3-(3,5-difluorophenyl)-4-oxo-8-(trifluoromethyl)quinazolin-2-yl]-N-ethylcarbamate |
| PubChem CID | 90238300 |
| Molecular Formula | C22H20F5N3O3 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | tert-butyl N-[3-(3,5-difluorophenyl)-4-oxo-8-(trifluoromethyl)quinazolin-2-yl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)c1nc2c(C(F)(F)F)cccc2c(=O)n1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C22H20F5N3O3/c1-5-29(20(32)33-21(2,3)4)19-28-17-15(7-6-8-16(17)22(25,26)27)18(31)30(19)14-10-12(23)9-13(24)11-14/h6-11H,5H2,1-4H3 |
| InChIKey | BNHKDJQYNVLUDA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[3-(3,5-difluorophenyl)-4-oxo-8-(trifluoromethyl)quinazolin-2-yl]-N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[3-(3,5-difluorophenyl)-4-oxo-8-(trifluoromethyl)quinazolin-2-yl]-N-ethylcarbamate?
The IUPAC name of tert-butyl N-[3-(3,5-difluorophenyl)-4-oxo-8-(trifluoromethyl)quinazolin-2-yl]-N-ethylcarbamate (CID 90238300) is tert-butyl N-[3-(3,5-difluorophenyl)-4-oxo-8-(trifluoromethyl)quinazolin-2-yl]-N-ethylcarbamate.
What is the SMILES notation for tert-butyl N-[3-(3,5-difluorophenyl)-4-oxo-8-(trifluoromethyl)quinazolin-2-yl]-N-ethylcarbamate?
The canonical SMILES for tert-butyl N-[3-(3,5-difluorophenyl)-4-oxo-8-(trifluoromethyl)quinazolin-2-yl]-N-ethylcarbamate is CCN(C(=O)OC(C)(C)C)c1nc2c(C(F)(F)F)cccc2c(=O)n1-c1cc(F)cc(F)c1.
What is the InChIKey of tert-butyl N-[3-(3,5-difluorophenyl)-4-oxo-8-(trifluoromethyl)quinazolin-2-yl]-N-ethylcarbamate?
The InChIKey is BNHKDJQYNVLUDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F5N3O3/c1-5-29(20(32)33-21(2,3)4)19-28-17-15(7-6-8-16(17)22(25,26)27)18(31)30(19)14-10-12(23)9-13(24)11-14/h6-11H,5H2,1-4H3.
What are the key properties of tert-butyl N-[3-(3,5-difluorophenyl)-4-oxo-8-(trifluoromethyl)quinazolin-2-yl]-N-ethylcarbamate?
tert-butyl N-[3-(3,5-difluorophenyl)-4-oxo-8-(trifluoromethyl)quinazolin-2-yl]-N-ethylcarbamate has a molecular weight of 469.41 g/mol, XLogP of 5.44, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[3-(3,5-difluorophenyl)-4-oxo-8-(trifluoromethyl)quinazolin-2-yl]-N-ethylcarbamate is sourced from PubChem (CID 90238300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).