C11H19NO3 — CID 90238317
[(3R,5S,6S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]carbamic acid (PubChem CID 90238317) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is [(3R,5S,6S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]carbamic acid.
| Compound Name | [(3R,5S,6S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 90238317 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | [(3R,5S,6S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]carbamic acid |
| SMILES | C=CC[C@@H]1OC(C)[C@H](NC(=O)O)C[C@@H]1C |
| InChI | InChI=1S/C11H19NO3/c1-4-5-10-7(2)6-9(8(3)15-10)12-11(13)14/h4,7-10,12H,1,5-6H2,2-3H3,(H,13,14)/t7-,8?,9+,10-/m0/s1 |
| InChIKey | LQXOCMRQZUSQIZ-GCIYTXSZSA-N |
| XLogP | 2.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|