C18H17N3O4 — CID 9023843
[4-[(Z)-benzimidazol-1-yliminomethyl]-2,6-dimethoxyphenyl] acetate (PubChem CID 9023843) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is [4-[(Z)-benzimidazol-1-yliminomethyl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[(Z)-benzimidazol-1-yliminomethyl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 9023843 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | [4-[(Z)-benzimidazol-1-yliminomethyl]-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1cc(/C=N\n2cnc3ccccc32)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C18H17N3O4/c1-12(22)25-18-16(23-2)8-13(9-17(18)24-3)10-20-21-11-19-14-6-4-5-7-15(14)21/h4-11H,1-3H3/b20-10- |
| InChIKey | VKLMHSSPOWNLJQ-JMIUGGIZSA-N |
| XLogP | 2.86 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|