C17H28O2 — CID 90238481
2-(4,8-dimethylnona-1,3,7-trienyl)-2,5-dimethyl-1,3-dioxane (PubChem CID 90238481) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-(4,8-dimethylnona-1,3,7-trienyl)-2,5-dimethyl-1,3-dioxane.
| Compound Name | 2-(4,8-dimethylnona-1,3,7-trienyl)-2,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 90238481 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 2-(4,8-dimethylnona-1,3,7-trienyl)-2,5-dimethyl-1,3-dioxane |
| SMILES | CC(C)=CCCC(C)=CC=CC1(C)OCC(C)CO1 |
| InChI | InChI=1S/C17H28O2/c1-14(2)8-6-9-15(3)10-7-11-17(5)18-12-16(4)13-19-17/h7-8,10-11,16H,6,9,12-13H2,1-5H3 |
| InChIKey | FJOQWLAKZHLLNU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|