C18H32O2 — CID 90238582
2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,5,5-trimethyl-1,3-dioxane (PubChem CID 90238582) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,5,5-trimethyl-1,3-dioxane.
| Compound Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,5,5-trimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 90238582 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,5,5-trimethyl-1,3-dioxane |
| SMILES | CC(C)=CCC/C(C)=C/CCC1(C)OCC(C)(C)CO1 |
| InChI | InChI=1S/C18H32O2/c1-15(2)9-7-10-16(3)11-8-12-18(6)19-13-17(4,5)14-20-18/h9,11H,7-8,10,12-14H2,1-6H3/b16-11+ |
| InChIKey | XJUXWWIQZMRNLI-LFIBNONCSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|