C35H39NO12 — CID 90238640
methyl 2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-carboxylate (PubChem CID 90238640) has the molecular formula C35H39NO12 and a molecular weight of 665.69 g/mol. Its IUPAC name is methyl 2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-carboxylate.
| Compound Name | methyl 2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 90238640 |
| Molecular Formula | C35H39NO12 |
| Molecular Weight | 665.69 g/mol |
| Exact Mass | 665.25 |
| IUPAC Name | methyl 2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-carboxylate |
| SMILES | COC(=O)N1CCC2(CC1)c1cc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)ccc1-c1ccc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc12 |
| InChI | InChI=1S/C35H39NO12/c1-46-34(45)36-12-10-35(11-13-36)22-14-18(4-8-24-28(39)32(43)30(41)26(16-37)47-24)2-6-20(22)21-7-3-19(15-23(21)35)5-9-25-29(40)33(44)31(42)27(17-38)48-25/h2-3,6-7,14-15,24-33,37-44H,10-13,16-17H2,1H3/t24-,25-,26-,27-,28-,29-,30-,31-,32-,33-/m1/s1 |
| InChIKey | RFDGSFUKAQZCEP-AIIMWISVSA-N |
| XLogP | -1.80 |
| TPSA | 209.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.69 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|