C23H40O2 — CID 90238654
2,5,5-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3-dioxane (PubChem CID 90238654) has the molecular formula C23H40O2 and a molecular weight of 348.57 g/mol. Its IUPAC name is 2,5,5-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3-dioxane.
| Compound Name | 2,5,5-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3-dioxane |
|---|---|
| PubChem CID | 90238654 |
| Molecular Formula | C23H40O2 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | 2,5,5-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3-dioxane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1(C)OCC(C)(C)CO1 |
| InChI | InChI=1S/C23H40O2/c1-19(2)11-8-12-20(3)13-9-14-21(4)15-10-16-23(7)24-17-22(5,6)18-25-23/h11,13,15H,8-10,12,14,16-18H2,1-7H3/b20-13+,21-15+ |
| InChIKey | CFRXBAUWHKLGFC-RSKMIKRQSA-N |
| XLogP | 6.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|