C34H38O13 — CID 90238688
3-[9-(2-hydroxyethyl)-2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]fluoren-9-yl]propanoic acid (PubChem CID 90238688) has the molecular formula C34H38O13 and a molecular weight of 654.67 g/mol. Its IUPAC name is 3-[9-(2-hydroxyethyl)-2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]fluoren-9-yl]propanoic acid.
| Compound Name | 3-[9-(2-hydroxyethyl)-2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]fluoren-9-yl]propanoic acid |
|---|---|
| PubChem CID | 90238688 |
| Molecular Formula | C34H38O13 |
| Molecular Weight | 654.67 g/mol |
| Exact Mass | 654.23 |
| IUPAC Name | 3-[9-(2-hydroxyethyl)-2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]fluoren-9-yl]propanoic acid |
| SMILES | O=C(O)CCC1(CCO)c2cc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)ccc2-c2ccc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc21 |
| InChI | InChI=1S/C34H38O13/c35-12-11-34(10-9-27(38)39)21-13-17(3-7-23-28(40)32(44)30(42)25(15-36)46-23)1-5-19(21)20-6-2-18(14-22(20)34)4-8-24-29(41)33(45)31(43)26(16-37)47-24/h1-2,5-6,13-14,23-26,28-33,35-37,40-45H,9-12,15-16H2,(H,38,39)/t23-,24-,25-,26-,28-,29-,30-,31-,32-,33-/m1/s1 |
| InChIKey | AAOJHEPYGKPVFS-XXUBWBAASA-N |
| XLogP | -2.41 |
| TPSA | 237.83 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.67 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|