C16H26O2 — CID 90238841
2-[(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-2-methyl-1,3-dioxane (PubChem CID 90238841) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-[(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-2-methyl-1,3-dioxane.
| Compound Name | 2-[(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-2-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 90238841 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2-[(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-2-methyl-1,3-dioxane |
| SMILES | CC(C)=CCC/C(C)=C/C=C/C1(C)OCCCO1 |
| InChI | InChI=1S/C16H26O2/c1-14(2)8-5-9-15(3)10-6-11-16(4)17-12-7-13-18-16/h6,8,10-11H,5,7,9,12-13H2,1-4H3/b11-6+,15-10+ |
| InChIKey | XVGCNPWZCGBBKZ-FDCMAIFOSA-N |
| XLogP | 4.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|