C22H21F2N3O3S — CID 90238863
N-[[2-(2,4-difluorophenyl)-4-hydroxy-4-(3-methyl-1,2-oxazol-4-yl)butan-2-yl]carbamothioyl]benzamide (PubChem CID 90238863) has the molecular formula C22H21F2N3O3S and a molecular weight of 445.49 g/mol. Its IUPAC name is N-[[2-(2,4-difluorophenyl)-4-hydroxy-4-(3-methyl-1,2-oxazol-4-yl)butan-2-yl]carbamothioyl]benzamide.
| Compound Name | N-[[2-(2,4-difluorophenyl)-4-hydroxy-4-(3-methyl-1,2-oxazol-4-yl)butan-2-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 90238863 |
| Molecular Formula | C22H21F2N3O3S |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | N-[[2-(2,4-difluorophenyl)-4-hydroxy-4-(3-methyl-1,2-oxazol-4-yl)butan-2-yl]carbamothioyl]benzamide |
| SMILES | Cc1nocc1C(O)CC(C)(NC(=S)NC(=O)c1ccccc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H21F2N3O3S/c1-13-16(12-30-27-13)19(28)11-22(2,17-9-8-15(23)10-18(17)24)26-21(31)25-20(29)14-6-4-3-5-7-14/h3-10,12,19,28H,11H2,1-2H3,(H2,25,26,29,31) |
| InChIKey | LNDZNCQKDQTSCJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|