C23H46O2 — CID 90238872
2,5,5-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-1,3-dioxane (PubChem CID 90238872) has the molecular formula C23H46O2 and a molecular weight of 354.62 g/mol. Its IUPAC name is 2,5,5-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-1,3-dioxane.
| Compound Name | 2,5,5-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-1,3-dioxane |
|---|---|
| PubChem CID | 90238872 |
| Molecular Formula | C23H46O2 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.35 |
| IUPAC Name | 2,5,5-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-1,3-dioxane |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCCC1(C)OCC(C)(C)CO1 |
| InChI | InChI=1S/C23H46O2/c1-19(2)11-8-12-20(3)13-9-14-21(4)15-10-16-23(7)24-17-22(5,6)18-25-23/h19-21H,8-18H2,1-7H3/t20-,21-/m1/s1 |
| InChIKey | HBYIIHBZRWCZPX-NHCUHLMSSA-N |
| XLogP | 7.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |