C18H36O2 — CID 90238888
2-[(4R)-4,8-dimethylnonyl]-2,5,5-trimethyl-1,3-dioxane (PubChem CID 90238888) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is 2-[(4R)-4,8-dimethylnonyl]-2,5,5-trimethyl-1,3-dioxane.
| Compound Name | 2-[(4R)-4,8-dimethylnonyl]-2,5,5-trimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 90238888 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | 2-[(4R)-4,8-dimethylnonyl]-2,5,5-trimethyl-1,3-dioxane |
| SMILES | CC(C)CCC[C@@H](C)CCCC1(C)OCC(C)(C)CO1 |
| InChI | InChI=1S/C18H36O2/c1-15(2)9-7-10-16(3)11-8-12-18(6)19-13-17(4,5)14-20-18/h15-16H,7-14H2,1-6H3/t16-/m1/s1 |
| InChIKey | RKRMEYGGSCPEMK-MRXNPFEDSA-N |
| XLogP | 5.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |