About 11-oxo-5,6-dihydrobenzo[b]carbazole-3-carbonitrile
11-oxo-5,6-dihydrobenzo[b]carbazole-3-carbonitrile (PubChem CID 90238920) has the molecular formula C17H10N2O
and a molecular weight of 258.28 g/mol. Its IUPAC name is 11-oxo-5,6-dihydrobenzo[b]carbazole-3-carbonitrile.
Molecular Properties
| Compound Name | 11-oxo-5,6-dihydrobenzo[b]carbazole-3-carbonitrile |
| PubChem CID | 90238920 |
| Molecular Formula | C17H10N2O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 11-oxo-5,6-dihydrobenzo[b]carbazole-3-carbonitrile |
| SMILES | N#Cc1ccc2c3c([nH]c2c1)Cc1ccccc1C3=O |
| InChI | InChI=1S/C17H10N2O/c18-9-10-5-6-13-14(7-10)19-15-8-11-3-1-2-4-12(11)17(20)16(13)15/h1-7,19H,8H2 |
| InChIKey | DGRAFQRWVAKEQF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 11-oxo-5,6-dihydrobenzo[b]carbazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-oxo-5,6-dihydrobenzo[b]carbazole-3-carbonitrile?
The IUPAC name of 11-oxo-5,6-dihydrobenzo[b]carbazole-3-carbonitrile (CID 90238920) is 11-oxo-5,6-dihydrobenzo[b]carbazole-3-carbonitrile.
What is the SMILES notation for 11-oxo-5,6-dihydrobenzo[b]carbazole-3-carbonitrile?
The canonical SMILES for 11-oxo-5,6-dihydrobenzo[b]carbazole-3-carbonitrile is N#Cc1ccc2c3c([nH]c2c1)Cc1ccccc1C3=O.
What is the InChIKey of 11-oxo-5,6-dihydrobenzo[b]carbazole-3-carbonitrile?
The InChIKey is DGRAFQRWVAKEQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10N2O/c18-9-10-5-6-13-14(7-10)19-15-8-11-3-1-2-4-12(11)17(20)16(13)15/h1-7,19H,8H2.
What are the key properties of 11-oxo-5,6-dihydrobenzo[b]carbazole-3-carbonitrile?
11-oxo-5,6-dihydrobenzo[b]carbazole-3-carbonitrile has a molecular weight of 258.28 g/mol, XLogP of 3.17, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-oxo-5,6-dihydrobenzo[b]carbazole-3-carbonitrile is sourced from PubChem (CID 90238920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).