C17H24F6O2 — CID 90239188
(6Z,8E)-2,6-dimethyl-10,10-bis(2,2,2-trifluoroethoxy)undeca-2,6,8-triene (PubChem CID 90239188) has the molecular formula C17H24F6O2 and a molecular weight of 374.37 g/mol. Its IUPAC name is (6Z,8E)-2,6-dimethyl-10,10-bis(2,2,2-trifluoroethoxy)undeca-2,6,8-triene.
| Compound Name | (6Z,8E)-2,6-dimethyl-10,10-bis(2,2,2-trifluoroethoxy)undeca-2,6,8-triene |
|---|---|
| PubChem CID | 90239188 |
| Molecular Formula | C17H24F6O2 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (6Z,8E)-2,6-dimethyl-10,10-bis(2,2,2-trifluoroethoxy)undeca-2,6,8-triene |
| SMILES | CC(C)=CCC/C(C)=C\C=C\C(C)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C17H24F6O2/c1-13(2)7-5-8-14(3)9-6-10-15(4,24-11-16(18,19)20)25-12-17(21,22)23/h6-7,9-10H,5,8,11-12H2,1-4H3/b10-6+,14-9- |
| InChIKey | YDEVGZQGZJSCGN-QIXAWMBPSA-N |
| XLogP | 6.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|