C9H5BrF3NS — CID 90239241
4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile (PubChem CID 90239241) has the molecular formula C9H5BrF3NS and a molecular weight of 296.11 g/mol. Its IUPAC name is 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile.
| Compound Name | 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile |
|---|---|
| PubChem CID | 90239241 |
| Molecular Formula | C9H5BrF3NS |
| Molecular Weight | 296.11 g/mol |
| Exact Mass | 294.93 |
| IUPAC Name | 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile |
| SMILES | N#Cc1ccc(Br)cc1SCC(F)(F)F |
| InChI | InChI=1S/C9H5BrF3NS/c10-7-2-1-6(4-14)8(3-7)15-5-9(11,12)13/h1-3H,5H2 |
| InChIKey | AMHKJJDAASEYAP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.11 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |