About 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile
4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile (PubChem CID 90239241) has the molecular formula C9H5BrF3NS
and a molecular weight of 296.11 g/mol. Its IUPAC name is 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile.
Molecular Properties
| Compound Name | 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile |
| PubChem CID | 90239241 |
| Molecular Formula | C9H5BrF3NS |
| Molecular Weight | 296.11 g/mol |
| Exact Mass | 294.93 |
| IUPAC Name | 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile |
| SMILES | N#Cc1ccc(Br)cc1SCC(F)(F)F |
| InChI | InChI=1S/C9H5BrF3NS/c10-7-2-1-6(4-14)8(3-7)15-5-9(11,12)13/h1-3H,5H2 |
| InChIKey | AMHKJJDAASEYAP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.11 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile?
The IUPAC name of 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile (CID 90239241) is 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile.
What is the SMILES notation for 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile?
The canonical SMILES for 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile is N#Cc1ccc(Br)cc1SCC(F)(F)F.
What is the InChIKey of 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile?
The InChIKey is AMHKJJDAASEYAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrF3NS/c10-7-2-1-6(4-14)8(3-7)15-5-9(11,12)13/h1-3H,5H2.
What are the key properties of 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile?
4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile has a molecular weight of 296.11 g/mol, XLogP of 3.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-(2,2,2-trifluoroethylsulfanyl)benzonitrile is sourced from PubChem (CID 90239241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).