C19H16ClF3O3 — CID 90239256
3-[2-chloro-4-prop-1-ynyl-6-(2,2,2-trifluoroethoxy)phenyl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 90239256) has the molecular formula C19H16ClF3O3 and a molecular weight of 384.78 g/mol. Its IUPAC name is 3-[2-chloro-4-prop-1-ynyl-6-(2,2,2-trifluoroethoxy)phenyl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-[2-chloro-4-prop-1-ynyl-6-(2,2,2-trifluoroethoxy)phenyl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 90239256 |
| Molecular Formula | C19H16ClF3O3 |
| Molecular Weight | 384.78 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 3-[2-chloro-4-prop-1-ynyl-6-(2,2,2-trifluoroethoxy)phenyl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | CC#Cc1cc(Cl)c(C2C(=O)C3CCC(C3)C2=O)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C19H16ClF3O3/c1-2-3-10-6-13(20)15(14(7-10)26-9-19(21,22)23)16-17(24)11-4-5-12(8-11)18(16)25/h6-7,11-12,16H,4-5,8-9H2,1H3 |
| InChIKey | NTSYTUDNIDOGGO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.78 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|