C15H30O2 — CID 90239347
2-(2,6-dimethylheptyl)-5,5-dimethyl-1,3-dioxane (PubChem CID 90239347) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is 2-(2,6-dimethylheptyl)-5,5-dimethyl-1,3-dioxane.
| Compound Name | 2-(2,6-dimethylheptyl)-5,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 90239347 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 2-(2,6-dimethylheptyl)-5,5-dimethyl-1,3-dioxane |
| SMILES | CC(C)CCCC(C)CC1OCC(C)(C)CO1 |
| InChI | InChI=1S/C15H30O2/c1-12(2)7-6-8-13(3)9-14-16-10-15(4,5)11-17-14/h12-14H,6-11H2,1-5H3 |
| InChIKey | PJFVQWMNQBMJSF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |