C16H30O2 — CID 90239511
2-(2,6-dimethylheptyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole (PubChem CID 90239511) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 2-(2,6-dimethylheptyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole.
| Compound Name | 2-(2,6-dimethylheptyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 90239511 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 2-(2,6-dimethylheptyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole |
| SMILES | CC(C)CCCC(C)CC1OC2CCCCC2O1 |
| InChI | InChI=1S/C16H30O2/c1-12(2)7-6-8-13(3)11-16-17-14-9-4-5-10-15(14)18-16/h12-16H,4-11H2,1-3H3 |
| InChIKey | SRFAJFKBOFAHLV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |