C11H9IN2 — CID 90239626
12-iodo-4,6-diazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9,11-pentaene (PubChem CID 90239626) has the molecular formula C11H9IN2 and a molecular weight of 296.11 g/mol. Its IUPAC name is 12-iodo-4,6-diazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9,11-pentaene.
| Compound Name | 12-iodo-4,6-diazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9,11-pentaene |
|---|---|
| PubChem CID | 90239626 |
| Molecular Formula | C11H9IN2 |
| Molecular Weight | 296.11 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 12-iodo-4,6-diazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9,11-pentaene |
| SMILES | IC1=CC=CC2=CN=CN3CCC1=C23 |
| InChI | InChI=1S/C11H9IN2/c12-10-3-1-2-8-6-13-7-14-5-4-9(10)11(8)14/h1-3,6-7H,4-5H2 |
| InChIKey | VUEVOGPWRWQAFF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.11 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|