C16H28O2 — CID 90239761
(3aS,7aR)-2-[(E)-2,6-dimethylhept-1-enyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole (PubChem CID 90239761) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (3aS,7aR)-2-[(E)-2,6-dimethylhept-1-enyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole.
| Compound Name | (3aS,7aR)-2-[(E)-2,6-dimethylhept-1-enyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 90239761 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (3aS,7aR)-2-[(E)-2,6-dimethylhept-1-enyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole |
| SMILES | C/C(=C\C1O[C@H]2CCCC[C@H]2O1)CCCC(C)C |
| InChI | InChI=1S/C16H28O2/c1-12(2)7-6-8-13(3)11-16-17-14-9-4-5-10-15(14)18-16/h11-12,14-16H,4-10H2,1-3H3/b13-11+/t14-,15+,16? |
| InChIKey | JRGDUGQXCKQYKQ-KYWQXSONSA-N |
| XLogP | 4.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|