About [5-[(E)-4-(5-formyl-1,3-benzoxazol-2-yl)but-1-enyl]-2-phenylphenyl]carbamic acid
[5-[(E)-4-(5-formyl-1,3-benzoxazol-2-yl)but-1-enyl]-2-phenylphenyl]carbamic acid (PubChem CID 90239919) has the molecular formula C25H20N2O4
and a molecular weight of 412.45 g/mol. Its IUPAC name is [5-[(E)-4-(5-formyl-1,3-benzoxazol-2-yl)but-1-enyl]-2-phenylphenyl]carbamic acid.
Molecular Properties
| Compound Name | [5-[(E)-4-(5-formyl-1,3-benzoxazol-2-yl)but-1-enyl]-2-phenylphenyl]carbamic acid |
| PubChem CID | 90239919 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | [5-[(E)-4-(5-formyl-1,3-benzoxazol-2-yl)but-1-enyl]-2-phenylphenyl]carbamic acid |
| SMILES | O=Cc1ccc2oc(CC/C=C/c3ccc(-c4ccccc4)c(NC(=O)O)c3)nc2c1 |
| InChI | InChI=1S/C25H20N2O4/c28-16-18-11-13-23-22(15-18)26-24(31-23)9-5-4-6-17-10-12-20(19-7-2-1-3-8-19)21(14-17)27-25(29)30/h1-4,6-8,10-16,27H,5,9H2,(H,29,30)/b6-4+ |
| InChIKey | INENBSBRKQPLTL-GQCTYLIASA-N |
| XLogP | 6.04 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [5-[(E)-4-(5-formyl-1,3-benzoxazol-2-yl)but-1-enyl]-2-phenylphenyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(E)-4-(5-formyl-1,3-benzoxazol-2-yl)but-1-enyl]-2-phenylphenyl]carbamic acid?
The IUPAC name of [5-[(E)-4-(5-formyl-1,3-benzoxazol-2-yl)but-1-enyl]-2-phenylphenyl]carbamic acid (CID 90239919) is [5-[(E)-4-(5-formyl-1,3-benzoxazol-2-yl)but-1-enyl]-2-phenylphenyl]carbamic acid.
What is the SMILES notation for [5-[(E)-4-(5-formyl-1,3-benzoxazol-2-yl)but-1-enyl]-2-phenylphenyl]carbamic acid?
The canonical SMILES for [5-[(E)-4-(5-formyl-1,3-benzoxazol-2-yl)but-1-enyl]-2-phenylphenyl]carbamic acid is O=Cc1ccc2oc(CC/C=C/c3ccc(-c4ccccc4)c(NC(=O)O)c3)nc2c1.
What is the InChIKey of [5-[(E)-4-(5-formyl-1,3-benzoxazol-2-yl)but-1-enyl]-2-phenylphenyl]carbamic acid?
The InChIKey is INENBSBRKQPLTL-GQCTYLIASA-N. The full InChI is InChI=1S/C25H20N2O4/c28-16-18-11-13-23-22(15-18)26-24(31-23)9-5-4-6-17-10-12-20(19-7-2-1-3-8-19)21(14-17)27-25(29)30/h1-4,6-8,10-16,27H,5,9H2,(H,29,30)/b6-4+.
What are the key properties of [5-[(E)-4-(5-formyl-1,3-benzoxazol-2-yl)but-1-enyl]-2-phenylphenyl]carbamic acid?
[5-[(E)-4-(5-formyl-1,3-benzoxazol-2-yl)but-1-enyl]-2-phenylphenyl]carbamic acid has a molecular weight of 412.45 g/mol, XLogP of 6.04, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(E)-4-(5-formyl-1,3-benzoxazol-2-yl)but-1-enyl]-2-phenylphenyl]carbamic acid is sourced from PubChem (CID 90239919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).