About prop-1-ene;pyrrolidine-2,5-dione
prop-1-ene;pyrrolidine-2,5-dione (PubChem CID 90240369) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is prop-1-ene;pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | prop-1-ene;pyrrolidine-2,5-dione |
| PubChem CID | 90240369 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | prop-1-ene;pyrrolidine-2,5-dione |
| SMILES | C=CC.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C4H5NO2.C3H6/c6-3-1-2-4(7)5-3;1-3-2/h1-2H2,(H,5,6,7);3H,1H2,2H3 |
| InChIKey | RWZRQOJCZMSFTK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze prop-1-ene;pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-ene;pyrrolidine-2,5-dione?
The IUPAC name of prop-1-ene;pyrrolidine-2,5-dione (CID 90240369) is prop-1-ene;pyrrolidine-2,5-dione.
What is the SMILES notation for prop-1-ene;pyrrolidine-2,5-dione?
The canonical SMILES for prop-1-ene;pyrrolidine-2,5-dione is C=CC.O=C1CCC(=O)N1.
What is the InChIKey of prop-1-ene;pyrrolidine-2,5-dione?
The InChIKey is RWZRQOJCZMSFTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.C3H6/c6-3-1-2-4(7)5-3;1-3-2/h1-2H2,(H,5,6,7);3H,1H2,2H3.
What are the key properties of prop-1-ene;pyrrolidine-2,5-dione?
prop-1-ene;pyrrolidine-2,5-dione has a molecular weight of 141.17 g/mol, XLogP of 0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-ene;pyrrolidine-2,5-dione is sourced from PubChem (CID 90240369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).