C27H37O7P — CID 90240840
[2-[2-(2-hydroxypropoxy)ethoxy]ethoxy-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 90240840) has the molecular formula C27H37O7P and a molecular weight of 504.56 g/mol. Its IUPAC name is [2-[2-(2-hydroxypropoxy)ethoxy]ethoxy-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [2-[2-(2-hydroxypropoxy)ethoxy]ethoxy-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 90240840 |
| Molecular Formula | C27H37O7P |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | [2-[2-(2-hydroxypropoxy)ethoxy]ethoxy-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(OCCOCCOCC(C)O)C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C27H37O7P/c1-17-12-19(3)24(20(4)13-17)26(29)35(31,34-11-10-32-8-9-33-16-23(7)28)27(30)25-21(5)14-18(2)15-22(25)6/h12-15,23,28H,8-11,16H2,1-7H3 |
| InChIKey | KAPYJDOOLHLPIP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|