C51H60N8O3 — CID 90241275
N,N'-bis[2-cyclopropyl-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-1-methoxy-N-methylpropane-1,3-diamine (PubChem CID 90241275) has the molecular formula C51H60N8O3 and a molecular weight of 833.09 g/mol. Its IUPAC name is N,N'-bis[2-cyclopropyl-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-1-methoxy-N-methylpropane-1,3-diamine.
| Compound Name | N,N'-bis[2-cyclopropyl-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-1-methoxy-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 90241275 |
| Molecular Formula | C51H60N8O3 |
| Molecular Weight | 833.09 g/mol |
| Exact Mass | 832.48 |
| IUPAC Name | N,N'-bis[2-cyclopropyl-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-1-methoxy-N-methylpropane-1,3-diamine |
| SMILES | COc1ccccc1C1CCN(c2nc(C3CC3)nc3ccc(NCCC(OC)N(C)c4ccc5nc(C6CC6)nc(N6CCC(c7ccccc7OC)CC6)c5c4)cc23)CC1 |
| InChI | InChI=1S/C51H60N8O3/c1-57(38-18-20-44-42(32-38)51(56-49(54-44)36-15-16-36)59-29-24-34(25-30-59)40-10-6-8-12-46(40)61-3)47(62-4)21-26-52-37-17-19-43-41(31-37)50(55-48(53-43)35-13-14-35)58-27-22-33(23-28-58)39-9-5-7-11-45(39)60-2/h5-12,17-20,31-36,47,52H,13-16,21-30H2,1-4H3 |
| InChIKey | XLPVOTKKTDLUPO-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 101.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.09 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|