C51H60N8O3 — CID 90241276
N,N'-bis[2-cyclopropyl-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-1-methoxy-N,N'-dimethylethane-1,2-diamine (PubChem CID 90241276) has the molecular formula C51H60N8O3 and a molecular weight of 833.09 g/mol. Its IUPAC name is N,N'-bis[2-cyclopropyl-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-1-methoxy-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N,N'-bis[2-cyclopropyl-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-1-methoxy-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 90241276 |
| Molecular Formula | C51H60N8O3 |
| Molecular Weight | 833.09 g/mol |
| Exact Mass | 832.48 |
| IUPAC Name | N,N'-bis[2-cyclopropyl-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-1-methoxy-N,N'-dimethylethane-1,2-diamine |
| SMILES | COc1ccccc1C1CCN(c2nc(C3CC3)nc3ccc(N(C)CC(OC)N(C)c4ccc5nc(C6CC6)nc(N6CCC(c7ccccc7OC)CC6)c5c4)cc23)CC1 |
| InChI | InChI=1S/C51H60N8O3/c1-56(37-18-20-43-41(30-37)50(54-48(52-43)35-14-15-35)58-26-22-33(23-27-58)39-10-6-8-12-45(39)60-3)32-47(62-5)57(2)38-19-21-44-42(31-38)51(55-49(53-44)36-16-17-36)59-28-24-34(25-29-59)40-11-7-9-13-46(40)61-4/h6-13,18-21,30-31,33-36,47H,14-17,22-29,32H2,1-5H3 |
| InChIKey | OHCDXRIQXRMTRN-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 92.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.09 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|