About 1-pyrazin-2-ylindazole
1-pyrazin-2-ylindazole (PubChem CID 90241496) has the molecular formula C11H8N4
and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-pyrazin-2-ylindazole.
Molecular Properties
| Compound Name | 1-pyrazin-2-ylindazole |
| PubChem CID | 90241496 |
| Molecular Formula | C11H8N4 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-pyrazin-2-ylindazole |
| SMILES | c1ccc2c(c1)cnn2-c1cnccn1 |
| InChI | InChI=1S/C11H8N4/c1-2-4-10-9(3-1)7-14-15(10)11-8-12-5-6-13-11/h1-8H |
| InChIKey | OMGQJKDTJGANEU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pyrazin-2-ylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrazin-2-ylindazole?
The IUPAC name of 1-pyrazin-2-ylindazole (CID 90241496) is 1-pyrazin-2-ylindazole.
What is the SMILES notation for 1-pyrazin-2-ylindazole?
The canonical SMILES for 1-pyrazin-2-ylindazole is c1ccc2c(c1)cnn2-c1cnccn1.
What is the InChIKey of 1-pyrazin-2-ylindazole?
The InChIKey is OMGQJKDTJGANEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4/c1-2-4-10-9(3-1)7-14-15(10)11-8-12-5-6-13-11/h1-8H.
What are the key properties of 1-pyrazin-2-ylindazole?
1-pyrazin-2-ylindazole has a molecular weight of 196.21 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrazin-2-ylindazole is sourced from PubChem (CID 90241496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).