About [5-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid
[5-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid (PubChem CID 90241607) has the molecular formula C5H6N2O3S
and a molecular weight of 174.18 g/mol. Its IUPAC name is [5-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [5-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid |
| PubChem CID | 90241607 |
| Molecular Formula | C5H6N2O3S |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | [5-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid |
| SMILES | O=C(O)Nc1ncc(CO)s1 |
| InChI | InChI=1S/C5H6N2O3S/c8-2-3-1-6-4(11-3)7-5(9)10/h1,8H,2H2,(H,6,7)(H,9,10) |
| InChIKey | AJCAUAAXPONAAZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid?
The IUPAC name of [5-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid (CID 90241607) is [5-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid.
What is the SMILES notation for [5-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid?
The canonical SMILES for [5-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid is O=C(O)Nc1ncc(CO)s1.
What is the InChIKey of [5-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid?
The InChIKey is AJCAUAAXPONAAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3S/c8-2-3-1-6-4(11-3)7-5(9)10/h1,8H,2H2,(H,6,7)(H,9,10).
What are the key properties of [5-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid?
[5-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid has a molecular weight of 174.18 g/mol, XLogP of 0.73, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid is sourced from PubChem (CID 90241607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).