C48H54N6O4 — CID 90241710
1,4-bis[(S)-[(5S)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]phthalazine (PubChem CID 90241710) has the molecular formula C48H54N6O4 and a molecular weight of 779.00 g/mol. Its IUPAC name is 1,4-bis[(S)-[(5S)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]phthalazine.
| Compound Name | 1,4-bis[(S)-[(5S)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]phthalazine |
|---|---|
| PubChem CID | 90241710 |
| Molecular Formula | C48H54N6O4 |
| Molecular Weight | 779.00 g/mol |
| Exact Mass | 778.42 |
| IUPAC Name | 1,4-bis[(S)-[(5S)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]phthalazine |
| SMILES | CC[C@@H]1CN2CCC1CC2[C@@H](Oc1nnc(O[C@@H](c2ccnc3ccc(OC)cc23)C2CC3CCN2C[C@H]3CC)c2ccccc12)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C48H54N6O4/c1-5-29-27-53-21-17-31(29)23-43(53)45(35-15-19-49-41-13-11-33(55-3)25-39(35)41)57-47-37-9-7-8-10-38(37)48(52-51-47)58-46(44-24-32-18-22-54(44)28-30(32)6-2)36-16-20-50-42-14-12-34(56-4)26-40(36)42/h7-16,19-20,25-26,29-32,43-46H,5-6,17-18,21-24,27-28H2,1-4H3/t29-,30-,31?,32?,43?,44?,45+,46+/m1/s1 |
| InChIKey | YUCBLVFHJWOYDN-DNJTVTDVSA-N |
| XLogP | 9.22 |
| TPSA | 94.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.00 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |