About 1-[4-(3,4-diethylpyrrolidin-1-yl)butyl]-3,4-diethylpyrrolidine
1-[4-(3,4-diethylpyrrolidin-1-yl)butyl]-3,4-diethylpyrrolidine (PubChem CID 90241940) has the molecular formula C20H40N2
and a molecular weight of 308.55 g/mol. Its IUPAC name is 1-[4-(3,4-diethylpyrrolidin-1-yl)butyl]-3,4-diethylpyrrolidine.
Molecular Properties
| Compound Name | 1-[4-(3,4-diethylpyrrolidin-1-yl)butyl]-3,4-diethylpyrrolidine |
| PubChem CID | 90241940 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | 1-[4-(3,4-diethylpyrrolidin-1-yl)butyl]-3,4-diethylpyrrolidine |
| SMILES | CCC1CN(CCCCN2CC(CC)C(CC)C2)CC1CC |
| InChI | InChI=1S/C20H40N2/c1-5-17-13-21(14-18(17)6-2)11-9-10-12-22-15-19(7-3)20(8-4)16-22/h17-20H,5-16H2,1-4H3 |
| InChIKey | FKAZUJGPAZJTMT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(3,4-diethylpyrrolidin-1-yl)butyl]-3,4-diethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,4-diethylpyrrolidin-1-yl)butyl]-3,4-diethylpyrrolidine?
The IUPAC name of 1-[4-(3,4-diethylpyrrolidin-1-yl)butyl]-3,4-diethylpyrrolidine (CID 90241940) is 1-[4-(3,4-diethylpyrrolidin-1-yl)butyl]-3,4-diethylpyrrolidine.
What is the SMILES notation for 1-[4-(3,4-diethylpyrrolidin-1-yl)butyl]-3,4-diethylpyrrolidine?
The canonical SMILES for 1-[4-(3,4-diethylpyrrolidin-1-yl)butyl]-3,4-diethylpyrrolidine is CCC1CN(CCCCN2CC(CC)C(CC)C2)CC1CC.
What is the InChIKey of 1-[4-(3,4-diethylpyrrolidin-1-yl)butyl]-3,4-diethylpyrrolidine?
The InChIKey is FKAZUJGPAZJTMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40N2/c1-5-17-13-21(14-18(17)6-2)11-9-10-12-22-15-19(7-3)20(8-4)16-22/h17-20H,5-16H2,1-4H3.
What are the key properties of 1-[4-(3,4-diethylpyrrolidin-1-yl)butyl]-3,4-diethylpyrrolidine?
1-[4-(3,4-diethylpyrrolidin-1-yl)butyl]-3,4-diethylpyrrolidine has a molecular weight of 308.55 g/mol, XLogP of 4.50, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,4-diethylpyrrolidin-1-yl)butyl]-3,4-diethylpyrrolidine is sourced from PubChem (CID 90241940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).