C23H50N2O2 — CID 90242283
1,3,4-triethyl-1-[3-(1,3,4-triethylpyrrolidin-1-ium-1-yl)propyl]pyrrolidin-1-ium dihydroxide (PubChem CID 90242283) has the molecular formula C23H50N2O2 and a molecular weight of 386.67 g/mol. Its IUPAC name is 1,3,4-triethyl-1-[3-(1,3,4-triethylpyrrolidin-1-ium-1-yl)propyl]pyrrolidin-1-ium dihydroxide.
| Compound Name | 1,3,4-triethyl-1-[3-(1,3,4-triethylpyrrolidin-1-ium-1-yl)propyl]pyrrolidin-1-ium dihydroxide |
|---|---|
| PubChem CID | 90242283 |
| Molecular Formula | C23H50N2O2 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 386.39 |
| IUPAC Name | 1,3,4-triethyl-1-[3-(1,3,4-triethylpyrrolidin-1-ium-1-yl)propyl]pyrrolidin-1-ium dihydroxide |
| SMILES | CCC1C[N+](CC)(CCC[N+]2(CC)CC(CC)C(CC)C2)CC1CC.[OH-].[OH-] |
| InChI | InChI=1S/C23H48N2.2H2O/c1-7-20-16-24(11-5,17-21(20)8-2)14-13-15-25(12-6)18-22(9-3)23(10-4)19-25;;/h20-23H,7-19H2,1-6H3;2*1H2/q+2;;/p-2 |
| InChIKey | AAFLMEFPVIEYTQ-UHFFFAOYSA-L |
| XLogP | 4.83 |
| TPSA | 60.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|