C22H21N3OS2 — CID 90242338
1'-[2-(1,3-thiazol-2-yl)-3H-1,2-benzothiazol-5-yl]spiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 90242338) has the molecular formula C22H21N3OS2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1'-[2-(1,3-thiazol-2-yl)-3H-1,2-benzothiazol-5-yl]spiro[1H-2-benzofuran-3,4'-piperidine].
| Compound Name | 1'-[2-(1,3-thiazol-2-yl)-3H-1,2-benzothiazol-5-yl]spiro[1H-2-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 90242338 |
| Molecular Formula | C22H21N3OS2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 1'-[2-(1,3-thiazol-2-yl)-3H-1,2-benzothiazol-5-yl]spiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | c1ccc2c(c1)COC21CCN(c2ccc3c(c2)CN(c2nccs2)S3)CC1 |
| InChI | InChI=1S/C22H21N3OS2/c1-2-4-19-16(3-1)15-26-22(19)7-10-24(11-8-22)18-5-6-20-17(13-18)14-25(28-20)21-23-9-12-27-21/h1-6,9,12-13H,7-8,10-11,14-15H2 |
| InChIKey | IKABAMQVTVUHJO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|