C18H23N3O4S — CID 9024283
6-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyridine-3-sulfonamide (PubChem CID 9024283) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 6-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyridine-3-sulfonamide.
| Compound Name | 6-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 9024283 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 6-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyridine-3-sulfonamide |
| SMILES | CCOc1cc2c(cc1OCC)CN(c1ccc(S(N)(=O)=O)cn1)CC2 |
| InChI | InChI=1S/C18H23N3O4S/c1-3-24-16-9-13-7-8-21(12-14(13)10-17(16)25-4-2)18-6-5-15(11-20-18)26(19,22)23/h5-6,9-11H,3-4,7-8,12H2,1-2H3,(H2,19,22,23) |
| InChIKey | WXCCRJWFSBBAPR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |