C23H38O — CID 90242976
(5R,6R,10R,14S,17R,19S)-6,14-dimethylpentacyclo[11.8.0.02,10.05,10.014,19]henicosan-17-ol (PubChem CID 90242976) has the molecular formula C23H38O and a molecular weight of 330.56 g/mol. Its IUPAC name is (5R,6R,10R,14S,17R,19S)-6,14-dimethylpentacyclo[11.8.0.02,10.05,10.014,19]henicosan-17-ol.
| Compound Name | (5R,6R,10R,14S,17R,19S)-6,14-dimethylpentacyclo[11.8.0.02,10.05,10.014,19]henicosan-17-ol |
|---|---|
| PubChem CID | 90242976 |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | (5R,6R,10R,14S,17R,19S)-6,14-dimethylpentacyclo[11.8.0.02,10.05,10.014,19]henicosan-17-ol |
| SMILES | C[C@@H]1CCC[C@]23CCC4C(CC[C@H]5C[C@H](O)CC[C@]45C)C2CC[C@H]13 |
| InChI | InChI=1S/C23H38O/c1-15-4-3-11-23-13-10-20-18(21(23)8-7-19(15)23)6-5-16-14-17(24)9-12-22(16,20)2/h15-21,24H,3-14H2,1-2H3/t15-,16+,17-,18?,19-,20?,21?,22+,23-/m1/s1 |
| InChIKey | JNFPNRYURGMXEO-WRTUITGASA-N |
| XLogP | 5.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |