C32H35FN4O3 — CID 90243067
N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-3H-benzimidazole-5-carboxamide (PubChem CID 90243067) has the molecular formula C32H35FN4O3 and a molecular weight of 542.66 g/mol. Its IUPAC name is N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 90243067 |
| Molecular Formula | C32H35FN4O3 |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-3H-benzimidazole-5-carboxamide |
| SMILES | CCOc1cc(CN2CC[C@H]3C(NC(=O)c4ccc5nc[nH]c5c4)CC[C@H]32)cc(OCC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C32H35FN4O3/c1-3-39-29-15-20(16-30(40-4-2)31(29)21-5-8-23(33)9-6-21)18-37-14-13-24-25(11-12-28(24)37)36-32(38)22-7-10-26-27(17-22)35-19-34-26/h5-10,15-17,19,24-25,28H,3-4,11-14,18H2,1-2H3,(H,34,35)(H,36,38)/t24-,25?,28+/m0/s1 |
| InChIKey | GHMDOALGZUQDHS-LCPJZUPGSA-N |
| XLogP | 5.95 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |