C34H40FN5O3 — CID 90243082
N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-1-propan-2-ylbenzotriazole-5-carboxamide (PubChem CID 90243082) has the molecular formula C34H40FN5O3 and a molecular weight of 585.72 g/mol. Its IUPAC name is N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-1-propan-2-ylbenzotriazole-5-carboxamide.
| Compound Name | N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-1-propan-2-ylbenzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 90243082 |
| Molecular Formula | C34H40FN5O3 |
| Molecular Weight | 585.72 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-1-propan-2-ylbenzotriazole-5-carboxamide |
| SMILES | CCOc1cc(CN2CC[C@H]3C(NC(=O)c4ccc5c(c4)nnn5C(C)C)CC[C@H]32)cc(OCC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C34H40FN5O3/c1-5-42-31-17-22(18-32(43-6-2)33(31)23-7-10-25(35)11-8-23)20-39-16-15-26-27(12-14-29(26)39)36-34(41)24-9-13-30-28(19-24)37-38-40(30)21(3)4/h7-11,13,17-19,21,26-27,29H,5-6,12,14-16,20H2,1-4H3,(H,36,41)/t26-,27?,29+/m0/s1 |
| InChIKey | ZUQZFMQUTQVFTQ-FOPXBJIPSA-N |
| XLogP | 6.40 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.72 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |