C32H36FN5O3 — CID 90243083
N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-1-methylbenzotriazole-5-carboxamide (PubChem CID 90243083) has the molecular formula C32H36FN5O3 and a molecular weight of 557.67 g/mol. Its IUPAC name is N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-1-methylbenzotriazole-5-carboxamide.
| Compound Name | N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-1-methylbenzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 90243083 |
| Molecular Formula | C32H36FN5O3 |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-1-methylbenzotriazole-5-carboxamide |
| SMILES | CCOc1cc(CN2CC[C@H]3C(NC(=O)c4ccc5c(c4)nnn5C)CC[C@H]32)cc(OCC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C32H36FN5O3/c1-4-40-29-16-20(17-30(41-5-2)31(29)21-6-9-23(33)10-7-21)19-38-15-14-24-25(11-13-27(24)38)34-32(39)22-8-12-28-26(18-22)35-36-37(28)3/h6-10,12,16-18,24-25,27H,4-5,11,13-15,19H2,1-3H3,(H,34,39)/t24-,25?,27+/m0/s1 |
| InChIKey | MVEUMBVKLSHVDY-RHXYESGPSA-N |
| XLogP | 5.35 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |