C33H37FN4O3 — CID 90243089
N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-2-methyl-3H-benzimidazole-5-carboxamide (PubChem CID 90243089) has the molecular formula C33H37FN4O3 and a molecular weight of 556.68 g/mol. Its IUPAC name is N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-2-methyl-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-2-methyl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 90243089 |
| Molecular Formula | C33H37FN4O3 |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | N-[(3aS,6aR)-1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-2-methyl-3H-benzimidazole-5-carboxamide |
| SMILES | CCOc1cc(CN2CC[C@H]3C(NC(=O)c4ccc5nc(C)[nH]c5c4)CC[C@H]32)cc(OCC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C33H37FN4O3/c1-4-40-30-16-21(17-31(41-5-2)32(30)22-6-9-24(34)10-7-22)19-38-15-14-25-26(12-13-29(25)38)37-33(39)23-8-11-27-28(18-23)36-20(3)35-27/h6-11,16-18,25-26,29H,4-5,12-15,19H2,1-3H3,(H,35,36)(H,37,39)/t25-,26?,29+/m0/s1 |
| InChIKey | BXRAPFPWEFHBHZ-GXMVQEQZSA-N |
| XLogP | 6.26 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |