About 1-adamantyldiazene
1-adamantyldiazene (PubChem CID 90243235) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-adamantyldiazene.
Molecular Properties
| Compound Name | 1-adamantyldiazene |
| PubChem CID | 90243235 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 1-adamantyldiazene |
| SMILES | [H]/N=N/C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H16N2/c11-12-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9,11H,1-6H2/b12-11+ |
| InChIKey | FNOKUHVDXPAWNL-VAWYXSNFSA-N |
| XLogP | 2.99 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyldiazene?
The IUPAC name of 1-adamantyldiazene (CID 90243235) is 1-adamantyldiazene.
What is the SMILES notation for 1-adamantyldiazene?
The canonical SMILES for 1-adamantyldiazene is [H]/N=N/C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantyldiazene?
The InChIKey is FNOKUHVDXPAWNL-VAWYXSNFSA-N. The full InChI is InChI=1S/C10H16N2/c11-12-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9,11H,1-6H2/b12-11+.
What are the key properties of 1-adamantyldiazene?
1-adamantyldiazene has a molecular weight of 164.25 g/mol, XLogP of 2.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyldiazene is sourced from PubChem (CID 90243235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).