C25H42O5Si — CID 90243260
methyl (Z)-5-[(1S,2R,4R,6R)-2-[(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]-6-hydroxy-4-methylcyclohexyl]-2-methyl-4-oxopent-2-enoate (PubChem CID 90243260) has the molecular formula C25H42O5Si and a molecular weight of 450.69 g/mol. Its IUPAC name is methyl (Z)-5-[(1S,2R,4R,6R)-2-[(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]-6-hydroxy-4-methylcyclohexyl]-2-methyl-4-oxopent-2-enoate.
| Compound Name | methyl (Z)-5-[(1S,2R,4R,6R)-2-[(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]-6-hydroxy-4-methylcyclohexyl]-2-methyl-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 90243260 |
| Molecular Formula | C25H42O5Si |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | methyl (Z)-5-[(1S,2R,4R,6R)-2-[(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]-6-hydroxy-4-methylcyclohexyl]-2-methyl-4-oxopent-2-enoate |
| SMILES | C=C(/C=C(\C)[C@@H]1C[C@@H](C)C[C@@H](O)[C@H]1CC(=O)/C=C(/C)C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H42O5Si/c1-16-11-21(17(2)13-19(4)30-31(9,10)25(5,6)7)22(23(27)12-16)15-20(26)14-18(3)24(28)29-8/h13-14,16,21-23,27H,4,11-12,15H2,1-3,5-10H3/b17-13+,18-14-/t16-,21+,22+,23-/m1/s1 |
| InChIKey | AOTKFUXQSJGODN-QIXYMWPBSA-N |
| XLogP | 5.57 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|