C27H49NO7 — CID 90243274
[(3S,4S,5R,6R)-5-acetyloxy-1-butoxy-6-[(2R,3S,5S)-3,5-dimethyl-4-(propanoylamino)oxan-2-yl]-2,4-dimethylheptan-3-yl] acetate (PubChem CID 90243274) has the molecular formula C27H49NO7 and a molecular weight of 499.69 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-5-acetyloxy-1-butoxy-6-[(2R,3S,5S)-3,5-dimethyl-4-(propanoylamino)oxan-2-yl]-2,4-dimethylheptan-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-5-acetyloxy-1-butoxy-6-[(2R,3S,5S)-3,5-dimethyl-4-(propanoylamino)oxan-2-yl]-2,4-dimethylheptan-3-yl] acetate |
|---|---|
| PubChem CID | 90243274 |
| Molecular Formula | C27H49NO7 |
| Molecular Weight | 499.69 g/mol |
| Exact Mass | 499.35 |
| IUPAC Name | [(3S,4S,5R,6R)-5-acetyloxy-1-butoxy-6-[(2R,3S,5S)-3,5-dimethyl-4-(propanoylamino)oxan-2-yl]-2,4-dimethylheptan-3-yl] acetate |
| SMILES | CCCCOCC(C)[C@H](OC(C)=O)[C@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H]1OC[C@@H](C)C(NC(=O)CC)[C@@H]1C |
| InChI | InChI=1S/C27H49NO7/c1-10-12-13-32-14-17(4)25(34-21(8)29)19(6)27(35-22(9)30)20(7)26-18(5)24(16(3)15-33-26)28-23(31)11-2/h16-20,24-27H,10-15H2,1-9H3,(H,28,31)/t16-,17?,18+,19+,20-,24?,25+,26-,27+/m1/s1 |
| InChIKey | MJMXIQKKTFRSBJ-DLECJXKDSA-N |
| XLogP | 4.14 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|