C7HF11O2 — CID 90243315
4,4,5-trifluoro-2-(1,1,2,3,3-pentafluoroprop-2-enyl)-2-(trifluoromethyl)-1,3-dioxolane (PubChem CID 90243315) has the molecular formula C7HF11O2 and a molecular weight of 326.06 g/mol. Its IUPAC name is 4,4,5-trifluoro-2-(1,1,2,3,3-pentafluoroprop-2-enyl)-2-(trifluoromethyl)-1,3-dioxolane.
| Compound Name | 4,4,5-trifluoro-2-(1,1,2,3,3-pentafluoroprop-2-enyl)-2-(trifluoromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 90243315 |
| Molecular Formula | C7HF11O2 |
| Molecular Weight | 326.06 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 4,4,5-trifluoro-2-(1,1,2,3,3-pentafluoroprop-2-enyl)-2-(trifluoromethyl)-1,3-dioxolane |
| SMILES | FC(F)=C(F)C(F)(F)C1(C(F)(F)F)OC(F)C(F)(F)O1 |
| InChI | InChI=1S/C7HF11O2/c8-1(2(9)10)4(12,13)6(7(16,17)18)19-3(11)5(14,15)20-6/h3H |
| InChIKey | MEZNXBGHVRKKBV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.06 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |